ABTS
2730088
205766643
2008-04-15T11:38:49Z
148.177.1.210
{{Chembox new
| ImageFile = ABTS.png
| ImageSize =
| IUPACName = 2,2'-azino-bis(3-ethylbenzthiazoline-6-sulphonic acid)
| OtherNames =
| Section1 = {{Chembox Identifiers
| CASNo = 28752-68-3
| PubChem =
| SMILES = CCN1/C(Sc2cc(ccc12)S(O)(=O)=O)=N/N=C/3Sc4cc(ccc4N3CC)S(O)(=O)=O
}}
| Section2 = {{Chembox Properties
| Formula = C<sub>18</sub>H<sub>18</sub>N<sub>4</sub>O<sub>6</sub>S<sub>4</sub>
| MolarMass = 514.62 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| Autoignition =
| RPhrases = {{R36}} {{R37}} {{R38}}
| SPhrases = {{S26}}-{{S36}}
}}
}}
In [[biochemistry]], '''2,2'-azino-bis(3-ethylbenzthiazoline-6-sulphonic acid)''' or '''ABTS''' is chemical compound used to observe the [[enzyme kinetics|reaction kinetics]] of specific [[enzyme]]s. A common use for it is in the [[enzyme-linked immunosorbent assay]] ([[ELISA]]) to detect for binding of molecules to each other.
It is commonly used as a [[substrate (biochemistry)|substrate]] with [[hydrogen peroxide]] for a [[peroxidase]] enzyme or alone with a [[laccase]] enzyme. Its use allows the reaction kinetics of [[peroxidases]] themselves to be followed. In this way it also can be used to indirectly follow the reaction kinetics of any [[hydrogen peroxide]] producing enzyme, or to simply quantify the amount of hydrogen peroxide in a sample.
<math>ABTS + H_2O_2 \overrightarrow{_{HRP}} ABTS^+ + H_2O</math>
This compound is chosen because the enzyme facilitates the reaction with hydrogen peroxide, turning it into a green and [[solubility|soluble]] end-product. Its new [[absorbance]] maximum of 405 nm [[light]] can easily be followed with a [[spectrophotometer]], a common laboratory instrument.
It is sometimes used as part of a [[glucose]] estimating [[reagent]] when finding glucose concentrations of solutions such as [[blood serum]].
{{biochem-stub}}
[[Category:Biochemistry methods]]
[[Category:Enzyme kinetics]]
[[Category:Sulfonic acids]]
[[de:ABTS]]
[[it:ABTS]]