ABTS 2730088 205766643 2008-04-15T11:38:49Z 148.177.1.210 {{Chembox new | ImageFile = ABTS.png | ImageSize = | IUPACName = 2,2'-azino-bis(3-ethylbenzthiazoline-6-sulphonic acid) | OtherNames = | Section1 = {{Chembox Identifiers | CASNo = 28752-68-3 | PubChem = | SMILES = CCN1/C(Sc2cc(ccc12)S(O)(=O)=O)=N/N=C/3Sc4cc(ccc4N3CC)S(O)(=O)=O }} | Section2 = {{Chembox Properties | Formula = C<sub>18</sub>H<sub>18</sub>N<sub>4</sub>O<sub>6</sub>S<sub>4</sub> | MolarMass = 514.62 g/mol | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} | Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | Autoignition = | RPhrases = {{R36}} {{R37}} {{R38}} | SPhrases = {{S26}}-{{S36}} }} }} In [[biochemistry]], '''2,2'-azino-bis(3-ethylbenzthiazoline-6-sulphonic acid)''' or '''ABTS''' is chemical compound used to observe the [[enzyme kinetics|reaction kinetics]] of specific [[enzyme]]s. A common use for it is in the [[enzyme-linked immunosorbent assay]] ([[ELISA]]) to detect for binding of molecules to each other. It is commonly used as a [[substrate (biochemistry)|substrate]] with [[hydrogen peroxide]] for a [[peroxidase]] enzyme or alone with a [[laccase]] enzyme. Its use allows the reaction kinetics of [[peroxidases]] themselves to be followed. In this way it also can be used to indirectly follow the reaction kinetics of any [[hydrogen peroxide]] producing enzyme, or to simply quantify the amount of hydrogen peroxide in a sample. <math>ABTS + H_2O_2 \overrightarrow{_{HRP}} ABTS^+ + H_2O</math> This compound is chosen because the enzyme facilitates the reaction with hydrogen peroxide, turning it into a green and [[solubility|soluble]] end-product. Its new [[absorbance]] maximum of 405 nm [[light]] can easily be followed with a [[spectrophotometer]], a common laboratory instrument. It is sometimes used as part of a [[glucose]] estimating [[reagent]] when finding glucose concentrations of solutions such as [[blood serum]]. {{biochem-stub}} [[Category:Biochemistry methods]] [[Category:Enzyme kinetics]] [[Category:Sulfonic acids]] [[de:ABTS]] [[it:ABTS]]