Argininosuccinic acid 3116341 198793501 2008-03-17T04:58:09Z Arcadian 104523 Reverted edits by [[Special:Contributions/69.91.130.217|69.91.130.217]] ([[User talk:69.91.130.217|talk]]) to last version by Edgar181 {{Chembox new |ImageFile=Argininosuccinic acid.png |ImageSize=200px |IUPACName=(2''S'')-2-[ [Amino-[(4''S'')-4-amino-5-hydroxy-5-oxopentyl]iminomethyl]amino]butanedioic acid |OtherNames= |Section1= {{Chembox Identifiers | CASNo=2387-71-5 | PubChem=16950 | SMILES=C(CC(C(=O)O)N)CN=C(N)NC(CC(=O)O)C(=O)O }} |Section2= {{Chembox Properties | Formula=C<sub>10</sub>H<sub>18</sub>N<sub>4</sub>O<sub>6</sub> | MolarMass=290.27312 | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= }} |Section3= {{Chembox Hazards | MainHazards= | FlashPt= | Autoignition= }} }} '''Argininosuccinic acid''' is a [[chemical compound]] which is a [[base (chemistry)|basic]] [[amino acid]]. ==Reactions== Some cells synthesize argininosuccinic acid from [[citrulline]] and [[aspartic acid]] and use it as a precursor for [[arginine]] in the [[urea cycle]] or [[citrulline-NO cycle]]. The enzyme that catalyzes the reaction is [[argininosuccinate synthetase]]. Argininosuccinic acid is a precursor to [[fumarate]] in the [[citric acid cycle]] via [[argininosuccinate lyase]]. ==See also== * [[Succinic acid]] {{Urea cycle}} [[Category:Basic amino acids]] [[Category:Guanidines]] [[zh:精氨基琥珀酸]]