Bumetanide
973959
214029879
2008-05-21T20:48:28Z
Thijs!bot
1392310
robot Adding: [[es:Bumetanida]]
{{drugbox
| IUPAC_name = 3-butylamino-4-phenoxy-5-sulfamoyl-benzoic acid
| image = Bumetanide structure.svg
| width = 156
| CAS_number = 28395-03-1
| ATC_prefix = C03
| ATC_suffix = CA02
| ATC_supplemental =
| PubChem = 2471
| DrugBank = APRD00294
| smiles = CCCCNc1cc(cc(c1Oc2ccccc2)S(N)(=O)=O)C(O)=O
| C = 17 | H = 20 | N = 2 | O = 5 | S = 1
| molecular_weight = 364.417 g/mol
| bioavailability = almost complete
| protein_bound = 97%
| metabolism = hepatic
| elimination_half-life = 60-90 minutes
| pregnancy_AU = B3
| pregnancy_US = C
| legal_AU = S4
| legal_UK = POM
| legal_US = Rx-only
| routes_of_administration = oral
| excretion = renal
}}
<!-- FAIR USE of Bumetanide_Bumex .gif: see image description page at http://en.wikipedia.org/wiki/Image:Bumetanide_Bumex .gif for rationale -->
'''Bumetanide''' is a [[loop diuretic]] of the sulfamyl category to treat [[heart failure]]. It is often used in patients in whom high doses of [[furosemide]] are ineffective. It is marketed by [[Hoffmann-La Roche]] with the brand name Bumex. The main difference between the two substances is in [[bioavailability]]. Furosemide is incompletely absorbed in the intestine (40%), and there is substantial inter- and intraindividual differences in bioavailability (range 10-90%). Bumetanide is completely absorbed (80%), and the absorption is not altered when it is taken with food. It is said to be a more predictable diuretic, meaning that the predictable absorption is reflected in a more predictable effect.
Bumetanide is 40 times more potent than furosemide (for patients with normal [[renal function]]).
==External links==
* [http://www.rocheusa.com/products/bumex/pi.pdf Bumex] (manufacturer's website)
* [http://www.meds-help.com/bumetanide/ Bumetanide] (patient information)
{{pharma-stub}}
{{Antihypertensives and diuretics}}
[[Category:Loop diuretics]]
[[es:Bumetanida]]
[[it:Bumetanide]]
[[th:บูมีทาไนด์]]