Bumetanide 973959 214029879 2008-05-21T20:48:28Z Thijs!bot 1392310 robot Adding: [[es:Bumetanida]] {{drugbox | IUPAC_name = 3-butylamino-4-phenoxy-5-sulfamoyl-benzoic acid | image = Bumetanide structure.svg | width = 156 | CAS_number = 28395-03-1 | ATC_prefix = C03 | ATC_suffix = CA02 | ATC_supplemental = | PubChem = 2471 | DrugBank = APRD00294 | smiles = CCCCNc1cc(cc(c1Oc2ccccc2)S(N)(=O)=O)C(O)=O | C = 17 | H = 20 | N = 2 | O = 5 | S = 1 | molecular_weight = 364.417 g/mol | bioavailability = almost complete | protein_bound = 97% | metabolism = hepatic | elimination_half-life = 60-90 minutes | pregnancy_AU = B3 | pregnancy_US = C | legal_AU = S4 | legal_UK = POM | legal_US = Rx-only | routes_of_administration = oral | excretion = renal }} <!-- FAIR USE of Bumetanide_Bumex .gif: see image description page at http://en.wikipedia.org/wiki/Image:Bumetanide_Bumex .gif for rationale --> '''Bumetanide''' is a [[loop diuretic]] of the sulfamyl category to treat [[heart failure]]. It is often used in patients in whom high doses of [[furosemide]] are ineffective. It is marketed by [[Hoffmann-La Roche]] with the brand name Bumex. The main difference between the two substances is in [[bioavailability]]. Furosemide is incompletely absorbed in the intestine (40%), and there is substantial inter- and intraindividual differences in bioavailability (range 10-90%). Bumetanide is completely absorbed (80%), and the absorption is not altered when it is taken with food. It is said to be a more predictable diuretic, meaning that the predictable absorption is reflected in a more predictable effect. Bumetanide is 40 times more potent than furosemide (for patients with normal [[renal function]]). ==External links== * [http://www.rocheusa.com/products/bumex/pi.pdf Bumex] (manufacturer's website) * [http://www.meds-help.com/bumetanide/ Bumetanide] (patient information) {{pharma-stub}} {{Antihypertensives and diuretics}} [[Category:Loop diuretics]] [[es:Bumetanida]] [[it:Bumetanide]] [[th:บูมีทาไนด์]]