Deoxyadenosine 89109 218336017 2008-06-10T04:49:30Z Arcadian 104523 nav {{Chembox new |ImageFile=DA chemical structure.png |ImageSize= |IUPACName= |OtherNames= |Section1= {{Chembox Identifiers | CASNo=958-09-8 | PubChem=636 | SMILES=C1C(C(OC1N2C=NC3=C2N=CN=C3N)CO)O | MeSHName=2'-deoxyadenosine }} |Section2= {{Chembox Properties | Formula=C<sub>10</sub>H<sub>13</sub>N<sub>5</sub>O<sub>3</sub> | MolarMass=251.24192 | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= }} |Section3= {{Chembox Hazards | MainHazards= | FlashPt= | Autoignition= }} }} '''Deoxyadenosine''' is [[deoxyribonucleoside]] and is considered a [[Derivative (chemistry)|derivative]] of the [[nucleoside]] [[adenosine]], differing from the latter by the replacement of a [[hydroxyl]] group (-OH) by hydrogen (-H) at the [[Nucleic acid nomenclature|2']] position of its [[ribose]] sugar moiety. ==See also== *[[Deoxyribonucleotide]] *[[Cordycepin]] ==References== {{Unreferenced|date =September 2007}} <references/> {{Nucleobases, nucleosides, and nucleotides}} [[Category:Nucleotides]] {{biochem-stub}} [[es:Desoxiadenosina]] [[it:Deossiadenosina]] [[pl:Deoksyadenozyna]] [[pt:Desoxiadenosina]] [[zh:去氧腺苷]]