Diatrizoic acid 3018144 225187320 2008-07-12T10:23:10Z Rifleman 82 1255637 pubchem {{Chembox new | Name = Diatrizoic acid | ImageFile = Diatrizoic acid.svg | ImageSize = 200px | ImageName = Diatrizoic acid | IUPACName = 3,5-diacetamido-2,4,6-triiodo-benzoic acid | Section1 = {{Chembox Identifiers | CASNo = 737-31-5 | PubChem = 2140 | SMILES = CC(=O)NC1=C(C(=C(C(=C1I)C(=O)O)I)NC(=O)C)I }} | Section2 = {{Chembox Properties | Formula = C<sub>11</sub>H<sub>9</sub>I<sub>3</sub>N<sub>2</sub>O<sub>4</sub> | MolarMass = 613.9 g/mol | Density = | MeltingPt = | BoilingPt = }} }} '''Diatrizoic acid''' (or its anionic form, '''Diatrizoate'''), also known as amidotrizoic acid, or 3,5-Diacetamido-2,4,6-triiodobenzoic acid, is an [[iodine]]-containing [[radiocontrast]] agent. It is also used to [[taeniacide|kill tapeworms]]. Diatrizoate is considered a high-[[osmolality]] contrast agent. Its osmolality ranges from approximately 1500 [[Osmole (unit)|mOsm]]/[[kilogram|kg]] (50% solution)<ref>{{cite web | url = http://dailymed.nlm.nih.gov/dailymed/fdaDrugXsl.cfm?id=1808&type=display | title = Hypaque sodium (Diatrizoate Sodium) injection, solution. Product label | author = Amersham Health | month = April | year = 2006 | accessdate = 2007-03-29 | publisher = U.S. [[National Library of Medicine]] | work = DailyMed}}</ref> to over 2000 mOsm/kg (76% solution).<ref>{{cite web | url = http://dailymed.nlm.nih.gov/dailymed/fdaDrugXsl.cfm?id=997&type=display | title = Hypaque (Diatrizoate Meglumine and Diatrizoate Sodium) injection, solution. Product label | author = Amersham Health | month = April | year = 2006 | accessdate = 2007-03-29 | publisher = U.S. [[National Library of Medicine]] | work = DailyMed}}</ref> ==Administration== *It is given [[intravenously]] (under brand name Hypaque®, [[GE Healthcare]]) to enhance contrast in [[computed tomography]], to image the [[kidney]]s and related structures, and to image blood vessels. *It is given orally or by [[enema]] (Gastrografin®, Gastrovist®, Gastrovision®, MD-Gastroview®) to image the [[gastrointestinal tract]]. *It is given by [[Foley catheter]] (Cystografin®) to image the [[urinary tract]] ==Contraindications== A history of sensitivity to iodine is not a contraindication to using diatrizoate, although it suggests caution in use of the agent. ==References== <references/> [[Category:Anthelmintics]] [[Category:Medical imaging]] [[Category:Organoiodides]] [[Category:Benzoic acids]] [[Category:Radiocontrast agents]] {{pharma-stub}} {{Anthelmintics}} [[de:Amidotrizoesäure]] [[fr:Acide diatrizoïque]]