Diatrizoic acid
3018144
225187320
2008-07-12T10:23:10Z
Rifleman 82
1255637
pubchem
{{Chembox new
| Name = Diatrizoic acid
| ImageFile = Diatrizoic acid.svg
| ImageSize = 200px
| ImageName = Diatrizoic acid
| IUPACName = 3,5-diacetamido-2,4,6-triiodo-benzoic acid
| Section1 = {{Chembox Identifiers
| CASNo = 737-31-5
| PubChem = 2140
| SMILES = CC(=O)NC1=C(C(=C(C(=C1I)C(=O)O)I)NC(=O)C)I
}}
| Section2 = {{Chembox Properties
| Formula = C<sub>11</sub>H<sub>9</sub>I<sub>3</sub>N<sub>2</sub>O<sub>4</sub>
| MolarMass = 613.9 g/mol
| Density =
| MeltingPt =
| BoilingPt =
}}
}}
'''Diatrizoic acid''' (or its anionic form, '''Diatrizoate'''), also known as amidotrizoic acid, or 3,5-Diacetamido-2,4,6-triiodobenzoic acid, is an [[iodine]]-containing [[radiocontrast]] agent. It is also used to [[taeniacide|kill tapeworms]].
Diatrizoate is considered a high-[[osmolality]] contrast agent. Its osmolality ranges from approximately 1500 [[Osmole (unit)|mOsm]]/[[kilogram|kg]] (50% solution)<ref>{{cite web | url = http://dailymed.nlm.nih.gov/dailymed/fdaDrugXsl.cfm?id=1808&type=display | title = Hypaque sodium (Diatrizoate Sodium) injection, solution. Product label | author = Amersham Health | month = April | year = 2006 | accessdate = 2007-03-29 | publisher = U.S. [[National Library of Medicine]] | work = DailyMed}}</ref> to over 2000 mOsm/kg (76% solution).<ref>{{cite web | url = http://dailymed.nlm.nih.gov/dailymed/fdaDrugXsl.cfm?id=997&type=display | title = Hypaque (Diatrizoate Meglumine and Diatrizoate Sodium) injection, solution. Product label | author = Amersham Health | month = April | year = 2006 | accessdate = 2007-03-29 | publisher = U.S. [[National Library of Medicine]] | work = DailyMed}}</ref>
==Administration==
*It is given [[intravenously]] (under brand name Hypaque®, [[GE Healthcare]]) to enhance contrast in [[computed tomography]], to image the [[kidney]]s and related structures, and to image blood vessels.
*It is given orally or by [[enema]] (Gastrografin®, Gastrovist®, Gastrovision®, MD-Gastroview®) to image the [[gastrointestinal tract]].
*It is given by [[Foley catheter]] (Cystografin®) to image the [[urinary tract]]
==Contraindications==
A history of sensitivity to iodine is not a contraindication to using diatrizoate, although it suggests caution in use of the agent.
==References==
<references/>
[[Category:Anthelmintics]]
[[Category:Medical imaging]]
[[Category:Organoiodides]]
[[Category:Benzoic acids]]
[[Category:Radiocontrast agents]]
{{pharma-stub}}
{{Anthelmintics}}
[[de:Amidotrizoesäure]]
[[fr:Acide diatrizoïque]]