Dimethylsulfoniopropionate
2000000
221179317
2008-06-23T11:27:45Z
DOI bot
6652755
Citation maintenance. You can [[WP:DOI|use this bot]] yourself! Please [[User:DOI_bot/bugs|report any bugs]].
{{Chembox new
|ImageFile=Dimethylsulfoniopropionate-2D-skeletal.png
|ImageSize=150px
|IUPACName=3-Dimethylsulfoniopropanoate
|OtherNames=
|Section1= {{Chembox Identifiers
| CASNo=7314-30-9
| PubChem=23736
| SMILES=C[S+](C)CCC(=O)[O-]
}}
|Section2= {{Chembox Properties
| Formula=C<sub>5</sub>H<sub>10</sub>O<sub>2</sub>S
| MolarMass=134.1967
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3= {{Chembox Hazards
| MainHazards=
| FlashPt=
| Autoignition=
}}
}}
'''Dimethylsulfoniopropionate''' ((CH<sub>3</sub>)<sub>2</sub>S<sup>+</sup>CH<sub>2</sub>CH<sub>2</sub>COO<sup>−</sup>; more frequently abbreviated to '''DMSP'''), is a [[metabolite]] found in marine [[phytoplankton]], [[seaweeds]] and some species of terrestrial and aquatic [[vascular plants]]. Older scientific literature refers to it as dimethyl-β-propiothetin. Although originally considered to act only as an [[osmolyte]], several other physiological and environmental roles have also been discovered.
DMSP is broken down by marine microbes to form two major volatile sulfur products, each with distinct effects on the environment. Its major breakdown product is [[methanethiol]] (CH<sub>3</sub>SH) which is assimilated by bacteria into [[protein]] sulfur.
Its second volatile breakdown product is [[dimethyl sulfide]] (CH<sub>3</sub>SCH<sub>3</sub>; DMS). Most DMS in seawater is cleaved from DMSP by the enzyme DMSP [[lyase]], although many non-marine species of bacteria convert [[methanethiol]] to DMS.
DMS is also taken up by marine [[bacteria]], but not as rapidly as methanethiol. Although DMS usually consists of less than 25% of the volatile breakdown products of DMSP, the high reactivity of methanethiol makes the steady-state DMS concentrations in seawater approximately 10 times those of methanethiol (~3 [[Mole (unit)|nM]] vs. ~0.3 nM). Curiously, there have never been any published correlations between the concentrations of DMS and methanethiol. This is probably due to the non-linear [[abiotic]] and microbial uptake of methanethiol in seawater, and the comparatively low reactivity of DMS. However, a significant portion of [[Dimethyl sulfide|DMS]] in seawater is [[redox|oxidized]] to [[dimethyl sulfoxide]] (DMSO).
There is a considerable interest in DMS in the scientific literature that focuses on [[global climate]]. DMS is thought to play a role in the earth's heat budget by decreasing the amount of [[solar radiation]] that reaches the earth's surface.
DMSP has also been implicated in influencing the taste and odour characteristics of various products. For example, although DMSP is odour- and tasteless, it is accumulated at high levels in some marine [[herbivory|herbivores]] or [[filter feeder]]s when feeding on diets with a high DMSP content. Increased growth rates, vigour and stress resistance among animals cultivated on such diets have been reported in the scientific literature. However, the volatile breakdown product of DMSP, DMS, is responsible for repellent, 'off' tastes and odours that develop in some seafood products after death because of the action of bacterial DMSP-[[lyase]] and during processing because of the thermal decomposition of DMSP into DMS and [[acrylate]].
==References==
* {{Cite journal
| doi = 10.1126/science.1151109
| volume = 319
| issue = 5868
| pages = 1356
| last = DeBose
| first = Jennifer L.
| coauthors = Sean C. Lema, Gabrielle A. Nevitt
| title = Dimethylsulfoniopropionate as a foraging cue for reef fishes
| journal = Science
| accessdate = 2008-03-21
| date = 2008-03-07
| url = http://www.sciencemag.org/cgi/content/abstract/319/5868/1356
| format = abstract
| pmid = 18323445
}}
* {{Cite journal
| doi = 10.1126/science.1131043
| volume = 314
| issue = 5799
| pages = 652–654
| last = Vila-Costa
| first = Maria
| coauthors = Rafel Simo, Hyakubun Harada, Josep M. Gasol, Doris Slezak, Ronald P. Kiene
| title = Dimethylsulfoniopropionate uptake by marine phytoplankton
| journal = Science
| accessdate = 2008-03-21
| date = 2006-10-27
| url = http://www.sciencemag.org/cgi/content/abstract/314/5799/652
| format = abstract
| pmid = 17068265
}}
==See also==
* [[CLAW hypothesis]] proposing a feedback loop that operates between ocean ecosystems and the Earth's climate.
==External links==
* [http://saga.pmel.noaa.gov/review/dms_climate.html DMS and Climate]
[[Category:Thioethers]]
[[Category:Carboxylate anions]]
[[Category:Planktology]]
[[ja:ジメチルスルフォニオプロピオネート]]