MBDB
1780699
225838200
2008-07-15T17:10:02Z
155.58.11.16
{{drugbox |
| IUPAC_name = 1-(1,3-Benzodioxol-5-yl)-N-methylbutan-2-amine
| image = MBDB structure.png
| image2 = MBDB-3d-sticks.png
| CAS_number = 103818-46-8
| ATC_prefix =
| ATC_suffix =
| PubChem = 124844
| C=12 | H=17 | N=1 | O=2
| molecular_weight = 207.27 g/mol
| smiles = CCC(CC1=CC2=C(C=C1)OCO2)NC
| melting_point = 156
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
}}
'''MBDB''', or '''3,4-methylenedioxy-alpha-[[ethyl]]-''N''-[[methyl]][[phenethylamine]]''', is a lesser-known [[Hallucinogenic drug|hallucinogenic]] [[phenethylamine]]. It is also known as "EDEN" or "Methyl-J." It is the alpha-[[ethyl]] [[Analog (chemistry)|analog]] of [[MDMA]] (Esctasy). It was first synthesized by [[David E. Nichols]], a leading [[pharmacologist]] and [[chemist]], and later tested by [[Alexander Shulgin]] and written up in his book, ''[[PiHKAL|PiHKAL (Phenethylamines i Have Known And Loved)]]''. MBDB's dosage, according to PiHKAL, is 180-210mg; the proper dosage relative to body mass seems unknown. Its duration is 4-6 hours, with noticeable after-effects lasting for 1-3 hours.
MBDB causes many mild, [[MDMA]]-like effects, such as lowering of social barriers and inhibitions, a pronounced [[Empathogen|sense of empathy and compassion]], and mild [[happiness]], [[Euphoria (emotion)|euphoria]], and enhanced [[emotions]] are all present. However, MBDB's effects are much less profound then those of MDMA. MBDB's effects tend to produce less [[Euphoria (emotion)|euphoria]], less [[psychedelia]], and have less [[Stimulant|stimulative properties]] than MDMA does. Many users declare that MBDB is a "watered-down" version of MDMA as MBDB loses action much more quickly, due to the milder effects, lack of a "rush," and its [[sedative]] effects. As with MDMA, users are at risk for acute [[dehydration]] if participating in strenuous physical activity and forget to drink [[water]], as the drug may mask one's normal sense of exhaustion and thirst.
== Contraindications ==
*[[MAOI]]s, specifically MAO-A inhibitors and non-selective MAOIs may precipitate [[serotonin syndrome]] when combined with MBDB.
*Driving and operating heavy machinery may be especially hazardous as MBDB has a fairly pronounced sedative action.
==External links==
*[http://www.erowid.org/library/books_online/pihkal/pihkal128.shtml PiHKAL entry]
*[http://www.erowid.org/chemicals/mbdb/mbdb.shtml Erowid MBDB vault]
{{Methylenedioxyphenethylamines}}
{{Entactogens}}
{{Phenethylamines}}
{{PiHKAL}}
[[Category:Alkaloids]]
[[Category:Amphetamines]]
[[Category:Entactogens and Empathogens]]
[[Category:Psychedelic phenethylamines]]
[[de:MBDB]]
[[fr:MBDB]]
[[pl:MBDB]]