MBDB 1780699 225838200 2008-07-15T17:10:02Z 155.58.11.16 {{drugbox | | IUPAC_name = 1-(1,3-Benzodioxol-5-yl)-N-methylbutan-2-amine | image = MBDB structure.png | image2 = MBDB-3d-sticks.png | CAS_number = 103818-46-8 | ATC_prefix = | ATC_suffix = | PubChem = 124844 | C=12 | H=17 | N=1 | O=2 | molecular_weight = 207.27 g/mol | smiles = CCC(CC1=CC2=C(C=C1)OCO2)NC | melting_point = 156 | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = }} '''MBDB''', or '''3,4-methylenedioxy-alpha-[[ethyl]]-''N''-[[methyl]][[phenethylamine]]''', is a lesser-known [[Hallucinogenic drug|hallucinogenic]] [[phenethylamine]]. It is also known as "EDEN" or "Methyl-J." It is the alpha-[[ethyl]] [[Analog (chemistry)|analog]] of [[MDMA]] (Esctasy). It was first synthesized by [[David E. Nichols]], a leading [[pharmacologist]] and [[chemist]], and later tested by [[Alexander Shulgin]] and written up in his book, ''[[PiHKAL|PiHKAL (Phenethylamines i Have Known And Loved)]]''. MBDB's dosage, according to PiHKAL, is 180-210mg; the proper dosage relative to body mass seems unknown. Its duration is 4-6 hours, with noticeable after-effects lasting for 1-3 hours. MBDB causes many mild, [[MDMA]]-like effects, such as lowering of social barriers and inhibitions, a pronounced [[Empathogen|sense of empathy and compassion]], and mild [[happiness]], [[Euphoria (emotion)|euphoria]], and enhanced [[emotions]] are all present. However, MBDB's effects are much less profound then those of MDMA. MBDB's effects tend to produce less [[Euphoria (emotion)|euphoria]], less [[psychedelia]], and have less [[Stimulant|stimulative properties]] than MDMA does. Many users declare that MBDB is a "watered-down" version of MDMA as MBDB loses action much more quickly, due to the milder effects, lack of a "rush," and its [[sedative]] effects. As with MDMA, users are at risk for acute [[dehydration]] if participating in strenuous physical activity and forget to drink [[water]], as the drug may mask one's normal sense of exhaustion and thirst. == Contraindications == *[[MAOI]]s, specifically MAO-A inhibitors and non-selective MAOIs may precipitate [[serotonin syndrome]] when combined with MBDB. *Driving and operating heavy machinery may be especially hazardous as MBDB has a fairly pronounced sedative action. ==External links== *[http://www.erowid.org/library/books_online/pihkal/pihkal128.shtml PiHKAL entry] *[http://www.erowid.org/chemicals/mbdb/mbdb.shtml Erowid MBDB vault] {{Methylenedioxyphenethylamines}} {{Entactogens}} {{Phenethylamines}} {{PiHKAL}} [[Category:Alkaloids]] [[Category:Amphetamines]] [[Category:Entactogens and Empathogens]] [[Category:Psychedelic phenethylamines]] [[de:MBDB]] [[fr:MBDB]] [[pl:MBDB]]