3-Amino-5-nitrosalicylic acid 2527500 225170785 2008-07-12T07:25:04Z JaGa 2092487 CAS typo {{Chembox new | Name = 3-Amino-5-nitrosalicylic acid | ImageFile = 3-amino-5-nitrosalicylic acid.svg <!-- | ImageSize = 150px --> | ImageName = 3-Amino-5-nitrosalicylic acid | ImageFile1 = 3-amino-5-nitrosalicylic-acid-3D-balls.png <!-- | ImageSize1 = 150px --> | ImageName1 = Ball-and-stick model of 3-amino-5-nitrosalicylic acid | Reference = <ref>[http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?sid=212207 3-Amino-5-nitrosalicylic acid - Substance Summary], [[PubChem]]</ref> | IUPACName = 3-amino-2-hydroxy-5-nitrobenzoic acid | Section1 = {{Chembox Identifiers | CASNo = 831-51-6 | SMILES = Nc1cc(cc(C(O)=O)c1O)[N+]([O-])=O }} | Section2 = {{Chembox Properties | Formula = C<sub>7</sub>H<sub>6</sub>N<sub>2</sub>O<sub>5</sub> | MolarMass = 198.13294 g/mol | Density = 1.730 ± 0.06 g/cm³ | MeltingPt = | BoilingPt = }} }} '''3-Amino-5-nitrosalicylic acid''' is an aromatic compound that absorbs light strongly at 540 [[1 E-9 m|nm]]. It is produced when [[3,5-dinitrosalicylic acid]] reacts with a [[reducing sugar]]. In this reaction, the 3-[[amino]] group (NH<sub>2</sub>) is replacing a [[nitrate]] group (NOO<sup>-</sup>). ==References== {{reflist}} {{DEFAULTSORT:Amino-5-nitrosalicylic acid, 3-}} [[Category:Aromatic amines]] [[Category:Benzoic acids]] {{amine-stub}}