Octyl salicylate 4345823 183995343 2008-01-13T06:36:12Z Rifleman 82 1255637 fix box {{Chembox new | Name = Octyl salicylate | ImageFile = Octyl_salicylate.png <!-- | ImageSize = 200px --> | ImageName = Octyl salicylate | IUPACName = 2-ethylhexyl 2-hydroxybenzoate | OtherNames = 2-ethylhexyl salicylate; octisalate; benzoic acid, 2-hydroxy-, 2-ethylhexyl ester; ethyl hexyl salicylate; salicylic acid, 2-ethylhexyl ester; 2-ethylhexyl ester benzoic acid, 2-hydroxy-; 2-ethylhexyl ester salicylic acid; 2-hydroxy- 2-ethylhexyl ester benzoic acid; benzoic acid, 2-hydroxy, 2-ethylhexyl ester; | Section1 = {{Chembox Identifiers | CASNo = 118-60-5 | SMILES = Oc1c(C(OCC(CCCC)CC)=O)cccc1 }} | Section2 = {{Chembox Properties | Formula = C<sub>15</sub>H<sub>22</sub>O<sub>3</sub> | MolarMass = 250.33 g/mol | Density = 1.014 g/cm<sup>3</sup> | MeltingPt =<25 °C | BoilingPt = 189 °C }} | Section7 = {{Chembox Hazards | NFPA-H = 1 | NFPA-F = 1 | NFPA-R = }} }} '''Octyl salicylate''', or '''2-ethylhexyl salicylate''', is an [[organic compound]] used as an ingredient in [[sunscreen]]s and cosmetics. It is an [[ester]] formed by the condensation of a [[salicylic acid]] with [[2-Ethylhexanol|2-ethylhexanol]]. It is a colorless oily liquid with a slight floral odor. The salicylate portion of the molecule absorbs [[ultraviolet light]], protecting skin from the harmful effects of exposure to [[sunlight]]. The ethylhexanol portion is a [[fatty alcohol]], adding [[emollient]] and oil-like (water resistant) properties. ==See also== *[[Sunscreen]] ==References== {{Citationstyle|date=September 2007}} {{reflist}} * [http://www.cosmeticsdatabase.com/wordsearch.php?query=Octisalate EWG query on Octisalate] [[Category:Carboxylate esters]] [[Category:Phenols]] [[Category:Sunscreening agents]] {{alcohol-stub}}