Octyl salicylate
4345823
183995343
2008-01-13T06:36:12Z
Rifleman 82
1255637
fix box
{{Chembox new
| Name = Octyl salicylate
| ImageFile = Octyl_salicylate.png
<!-- | ImageSize = 200px -->
| ImageName = Octyl salicylate
| IUPACName = 2-ethylhexyl 2-hydroxybenzoate
| OtherNames = 2-ethylhexyl salicylate; octisalate; benzoic acid, 2-hydroxy-, 2-ethylhexyl ester; ethyl hexyl salicylate; salicylic acid, 2-ethylhexyl ester; 2-ethylhexyl ester benzoic acid, 2-hydroxy-; 2-ethylhexyl ester salicylic acid; 2-hydroxy- 2-ethylhexyl ester benzoic acid; benzoic acid, 2-hydroxy, 2-ethylhexyl ester;
| Section1 = {{Chembox Identifiers
| CASNo = 118-60-5
| SMILES = Oc1c(C(OCC(CCCC)CC)=O)cccc1
}}
| Section2 = {{Chembox Properties
| Formula = C<sub>15</sub>H<sub>22</sub>O<sub>3</sub>
| MolarMass = 250.33 g/mol
| Density = 1.014 g/cm<sup>3</sup>
| MeltingPt =<25 °C
| BoilingPt = 189 °C
}}
| Section7 = {{Chembox Hazards
| NFPA-H = 1
| NFPA-F = 1
| NFPA-R =
}}
}}
'''Octyl salicylate''', or '''2-ethylhexyl salicylate''', is an [[organic compound]] used as an ingredient in [[sunscreen]]s and cosmetics. It is an [[ester]] formed by the condensation of a [[salicylic acid]] with [[2-Ethylhexanol|2-ethylhexanol]]. It is a colorless oily liquid with a slight floral odor.
The salicylate portion of the molecule absorbs [[ultraviolet light]], protecting skin from the harmful effects of exposure to [[sunlight]]. The ethylhexanol portion is a [[fatty alcohol]], adding [[emollient]] and oil-like (water resistant) properties.
==See also==
*[[Sunscreen]]
==References==
{{Citationstyle|date=September 2007}}
{{reflist}}
* [http://www.cosmeticsdatabase.com/wordsearch.php?query=Octisalate EWG query on Octisalate]
[[Category:Carboxylate esters]]
[[Category:Phenols]]
[[Category:Sunscreening agents]]
{{alcohol-stub}}