Propyl gallate
3818310
204969528
2008-04-11T18:30:40Z
69.151.107.82
/* Uses */
{{Chembox new
| Name = Propyl gallate
| ImageFile = Propyl gallate.svg
| ImageSize = 220px
| ImageName = Propyl gallate
| IUPACName = Propyl 3,4,5-trihydroxybenzoate
| OtherNames = Gallic acid, propyl ester<br>''N''-Propyl gallate<br>E310
| Section1 = {{Chembox Identifiers
| CASNo = 121-79-9
| EINECS = 204-498-2
| PubChem = 4947
| SMILES = CCCOC(=O)C1=CC(=C(C(=C1)O)O)O
| MeSHName = Propyl+Gallate
}}
| Section2 = {{Chembox Properties
| Formula = [[Carbon|C]]<sub>10</sub>[[Hydrogen|H]]<sub>12</sub>[[Oxygen|O]]<sub>5</sub>
| MolarMass = 212.20 g/mol
| Appearance = White crystalline powder
| Density =
| MeltingPt = 150 °C
| BoilingPt = Decomposes
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| Autoignition =
}}
}}
'''Propyl gallate''', or propyl 3,4,5-trihydroxybenzoate is an [[ester]] formed by the [[condensation]] of [[gallic acid]] and [[Propan-1-ol|propanol]]. It is an [[antioxidant]] added to foods containing oils and fats to prevent [[oxidation]].{{Fact|date=February 2007}} As a food additive, it is used under the [[E number]] '''E310'''.
==Description==
Propyl gallate is an anti-oxidant. It protects against oxidation by hydrogen peroxide and oxygen free radicals, in a catalytic manner similar to [[superoxide dismutase]].
==Uses==
Propyl gallate is used to protect oils and fats in products from oxidation.
It is used in foods, cosmetics, hair products, adhesives, and lubricants.
It is used as a triplet quencher in fluorescence microscopy.
==References==
{{Unreferenced|date=February 2008}}
<references/>
[[Category:Antioxidants]]
[[Category:Carboxylate esters]]
[[Category:Food antioxidants]]
[[Category:Phenols]]
{{ingredient-stub}}
{{alcohol-stub}}
[[hu:Propil-gallát]]