Propyl gallate 3818310 204969528 2008-04-11T18:30:40Z 69.151.107.82 /* Uses */ {{Chembox new | Name = Propyl gallate | ImageFile = Propyl gallate.svg | ImageSize = 220px | ImageName = Propyl gallate | IUPACName = Propyl&nbsp;3,4,5-trihydroxybenzoate | OtherNames = Gallic acid, propyl ester<br>''N''-Propyl gallate<br>E310 | Section1 = {{Chembox Identifiers | CASNo = 121-79-9 | EINECS = 204-498-2 | PubChem = 4947 | SMILES = CCCOC(=O)C1=CC(=C(C(=C1)O)O)O | MeSHName = Propyl+Gallate }} | Section2 = {{Chembox Properties | Formula = [[Carbon|C]]<sub>10</sub>[[Hydrogen|H]]<sub>12</sub>[[Oxygen|O]]<sub>5</sub> | MolarMass = 212.20 g/mol | Appearance = White crystalline powder | Density = | MeltingPt = 150&nbsp;&deg;C | BoilingPt = Decomposes | Solubility = }} | Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | Autoignition = }} }} '''Propyl gallate''', or propyl 3,4,5-trihydroxybenzoate is an [[ester]] formed by the [[condensation]] of [[gallic acid]] and [[Propan-1-ol|propanol]]. It is an [[antioxidant]] added to foods containing oils and fats to prevent [[oxidation]].{{Fact|date=February 2007}} As a food additive, it is used under the [[E number]] '''E310'''. ==Description== Propyl gallate is an anti-oxidant. It protects against oxidation by hydrogen peroxide and oxygen free radicals, in a catalytic manner similar to [[superoxide dismutase]]. ==Uses== Propyl gallate is used to protect oils and fats in products from oxidation. It is used in foods, cosmetics, hair products, adhesives, and lubricants. It is used as a triplet quencher in fluorescence microscopy. ==References== {{Unreferenced|date=February 2008}} <references/> [[Category:Antioxidants]] [[Category:Carboxylate esters]] [[Category:Food antioxidants]] [[Category:Phenols]] {{ingredient-stub}} {{alcohol-stub}} [[hu:Propil-gallát]]