Saccharic acid 1801877 169385706 2007-11-05T15:03:23Z Baronnet 574159 [[fr:Acide saccharique]] {{Chembox new |ImageFile=Glucaric acid structure.svg |ImageSize= |IUPACName=(2S,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanedioic acid |OtherNames=Glucaric acid |Section1= {{Chembox Identifiers | CASNo= | PubChem=33037 | SMILES=C(C(C(C(=O)O)O)O)(C(C(=O)O)O)O }} |Section2= {{Chembox Properties | Formula=C<sub>6</sub>H<sub>10</sub>O<sub>8</sub> | MolarMass=210.1388 | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= }} |Section3= {{Chembox Hazards | MainHazards= | FlashPt= | Autoignition= }} }} '''Saccharic acid''', also called '''glucaric acid''', is a [[chemical compound]] with the formula C<sub>6</sub>H<sub>10</sub>O<sub>8</sub>. It is derived by [[oxidizing]] a [[Monosaccharide|sugar]] such as [[glucose]] with [[nitric acid]].<ref>[http://www.m-w.com/medical/saccharic+acid Saccharic acid] at Merriam-Webster's Medical Dictionary</ref> ==References== <references/> [[Category:Monosaccharides]] [[Category:Sugar acids]] {{organic-compound-stub}} [[fr:Acide saccharique]]