Torasemide 4498606 223526244 2008-07-04T13:21:53Z RDBrown 539176 => Cite Journal with Wikipedia template filling, add reflist {{drugbox | IUPAC_name = 1-[4-(3-methylphenyl) aminopyridin-3-yl] sulfonyl-3-propan-2-yl-urea | image = Torasemide.svg | CAS_number = 56211-40-6 | ATC_prefix = C03 | ATC_suffix = CA04 | ATC_supplemental = | PubChem = 41781 | DrugBank = APRD00217 | smiles = CC(C)NC(=O)NS(=O)(=O)c1cnccc1Nc2cccc(C)c2 | C=16 | H=20 | N=4 | O=3 | S=1 | molecular_weight = 348.421 g/mol | bioavailability = 80-90% | protein_bound = Highly bound (>99%). | metabolism = Hepatic (80%) | elimination_half-life = 3.5 hours; [[Cirrhosis]]: 7-8 hours | pregnancy_US = C | legal_US = Rx-only | routes_of_administration = Oral, [[Intraveneous|IV]] }} '''Torasemide''' ([[International Nonproprietary Name|rINN]]) or '''torsemide''' ([[United States Approved Name|USAN]]) is a [[pyridine]]-[[sulfonyl]][[urea]] type [[loop diuretic]] mainly used in the management of [[edema]] associated with [[congestive heart failure]]. It is also used at low doses for the management of [[hypertension]]. It is marketed under the brand name '''Demadex'''. Compared to other loop diuretics, torasemide has a more prolonged [[diuretic]] effect than equipotent doses of [[furosemide]] and relatively decreased [[potassium]]-loss. There is no evidence of torasemide-induced [[ototoxicity]] demonstrated in humans <ref>{{cite journal |author=Dunn CJ, Fitton A, Brogden RN |title=Torasemide. An update of its pharmacological properties and therapeutic efficacy |journal=Drugs |volume=49 |issue=1 |pages=121–42 |year=1995 |month=January |pmid=7705212 |doi= |url=}}</ref>. ==References== {{reflist}} ==External links== * [http://www.nlm.nih.gov/medlineplus/druginfo/medmaster/a601212.html Medlineplus drug information: Torsemide (Systemic)] – information from USP DI Advice for the Patient {{Antihypertensives and diuretics}} [[Category:Loop diuretics]] [[Category:Sulfonylureas]] {{pharma-stub}} [[de:Torasemid]] [[es:Torsemida]] [[hr:Torasemid]] [[it:Torasemide]] [[pl:Torasemid]]