Torasemide
4498606
223526244
2008-07-04T13:21:53Z
RDBrown
539176
=> Cite Journal with Wikipedia template filling, add reflist
{{drugbox
| IUPAC_name = 1-[4-(3-methylphenyl) aminopyridin-3-yl] sulfonyl-3-propan-2-yl-urea
| image = Torasemide.svg
| CAS_number = 56211-40-6
| ATC_prefix = C03
| ATC_suffix = CA04
| ATC_supplemental =
| PubChem = 41781
| DrugBank = APRD00217
| smiles = CC(C)NC(=O)NS(=O)(=O)c1cnccc1Nc2cccc(C)c2
| C=16 | H=20 | N=4 | O=3 | S=1
| molecular_weight = 348.421 g/mol
| bioavailability = 80-90%
| protein_bound = Highly bound (>99%).
| metabolism = Hepatic (80%)
| elimination_half-life = 3.5 hours; [[Cirrhosis]]: 7-8 hours
| pregnancy_US = C
| legal_US = Rx-only
| routes_of_administration = Oral, [[Intraveneous|IV]]
}}
'''Torasemide''' ([[International Nonproprietary Name|rINN]]) or '''torsemide''' ([[United States Approved Name|USAN]]) is a [[pyridine]]-[[sulfonyl]][[urea]] type [[loop diuretic]] mainly used in the management of [[edema]] associated with [[congestive heart failure]]. It is also used at low doses for the management of [[hypertension]]. It is marketed under the brand name '''Demadex'''.
Compared to other loop diuretics, torasemide has a more prolonged [[diuretic]] effect than equipotent doses of [[furosemide]] and relatively decreased [[potassium]]-loss. There is no evidence of torasemide-induced [[ototoxicity]] demonstrated in humans <ref>{{cite journal |author=Dunn CJ, Fitton A, Brogden RN |title=Torasemide. An update of its pharmacological properties and therapeutic efficacy |journal=Drugs |volume=49 |issue=1 |pages=121–42 |year=1995 |month=January |pmid=7705212 |doi= |url=}}</ref>.
==References==
{{reflist}}
==External links==
* [http://www.nlm.nih.gov/medlineplus/druginfo/medmaster/a601212.html Medlineplus drug information: Torsemide (Systemic)] – information from USP DI Advice for the Patient
{{Antihypertensives and diuretics}}
[[Category:Loop diuretics]]
[[Category:Sulfonylureas]]
{{pharma-stub}}
[[de:Torasemid]]
[[es:Torsemida]]
[[hr:Torasemid]]
[[it:Torasemide]]
[[pl:Torasemid]]